4-(γ-Glutamylamino)butanoic acid

From HandWiki - Reading time: 2 min


4-(γ-Glutamylamino)butanoic acid
Stereo, skeletal formula of 4-(γ-glutamylamino)butanoic acid (S)
Names
Preferred IUPAC name
2-Amino-5-[(4-hydroxy-4-oxobutyl)amino]-5-oxopentanoic acid[citation needed]
Systematic IUPAC name
4-Amino-5-((3-carboxypropyl)amino)-5-oxopentanoic acid[citation needed]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)
Infobox references

|Section1=! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers

|-













| CASNo = 5105-96-4 | CASNo_Ref =  checkY | CASNo_Comment = S | PubChem = 355553 | PubChem1 = 23724570 | PubChem1_Comment = S | ChemSpiderID = 315618 | ChemSpiderID_Ref =  checkY | KEGG = C15767 | KEGG_Ref =  checkY | ChEBI = 49260 | ChEBI_Ref =  checkY | ChEMBL = 269574 | ChEMBL_Ref =  checkY | Beilstein = 2418119 | SMILES = NC(CCC(=O)NCCCC(O)=O)C(O)=O | StdInChI = 1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16) | StdInChI_Ref =  checkY | StdInChIKey = MKYPKZSGLSOGLL-UHFFFAOYSA-N | StdInChIKey_Ref =  checkY }} |Section2=! colspan=2 style="background: #f8eaba; text-align: center;" |Properties

|-

|

| C9H16N2O5

|- | Molar mass

| 232.236 g·mol−1

|-









| log P | −1.434 |-


| Acidity (pKa) | 2.223 |- | Basicity (pKb) | 11.777 |- |Section3=! colspan=2 style="background: #f8eaba; text-align: center;" |Related compounds

|-


|

Related alkanoic acids

|

|- }}

4-(γ-Glutamylamino)butanoic acid is molecule that consists of L-glutamate conjugated to γ-aminobutyric acid (GABA). It is the substrate of the enzyme γ-glutamyl-γ-aminobutyrate hydrolase, which is involved in the biosynthesis of polyamines.[1]

References

  1. "A novel putrescine utilization pathway involves gamma-glutamylated intermediates of Escherichia coli K-12". J. Biol. Chem. 280 (6): 4602–8. 2005. doi:10.1074/jbc.M411114200. PMID 15590624. 





Licensed under CC BY-SA 3.0 | Source: https://handwiki.org/wiki/Chemistry:4-(γ-Glutamylamino)butanoic_acid
1 | Status: cached on January 25 2026 23:46:44
↧ Download this article as ZWI file
Encyclosphere.org EncycloReader is supported by the EncyclosphereKSF