4-(γ-Glutamylamino)butanoic acid

4-(γ-Glutamylamino)butanoic acid

Names
Preferred IUPAC name 2-Amino-5-[(4-hydroxy-4-oxobutyl)amino]-5-oxopentanoic acid[citation needed]
Systematic IUPAC name 4-Amino-5-((3-carboxypropyl)amino)-5-oxopentanoic acid[citation needed]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is YN ?)
Infobox references

|Section1=! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers

|-

| CASNo = 5105-96-4 | CASNo_Ref =  ^Y | CASNo_Comment = S | PubChem = 355553 | PubChem1 = 23724570 | PubChem1_Comment = S | ChemSpiderID = 315618 | ChemSpiderID_Ref =  ^Y | KEGG = C15767 | KEGG_Ref =  ^Y | ChEBI = 49260 | ChEBI_Ref =  ^Y | ChEMBL = 269574 | ChEMBL_Ref =  ^Y | Beilstein = 2418119 | SMILES = NC(CCC(=O)NCCCC(O)=O)C(O)=O | StdInChI = 1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16) | StdInChI_Ref =  ^Y | StdInChIKey = MKYPKZSGLSOGLL-UHFFFAOYSA-N | StdInChIKey_Ref =  ^Y }} |Section2=! colspan=2 style="background: #f8eaba; text-align: center;" |Properties

|-

|

| C₉H₁₆N₂O₅

|- | Molar mass

| 232.236 g·mol⁻¹

|-

| log P | −1.434 |-

| Acidity (pK_a) | 2.223 |- | Basicity (pK_b) | 11.777 |- |Section3=! colspan=2 style="background: #f8eaba; text-align: center;" |Related compounds

|-

|

|

|- }}

4-(γ-Glutamylamino)butanoic acid is molecule that consists of L-glutamate conjugated to γ-aminobutyric acid (GABA). It is the substrate of the enzyme γ-glutamyl-γ-aminobutyrate hydrolase, which is involved in the biosynthesis of polyamines.^[1]

References

0.00 (0 votes) Original source: https://en.wikipedia.org/wiki/4-(γ-Glutamylamino)butanoic acid. Read more