Titanium bis(acetylacetonate)dichloride
|
| Names
|
| IUPAC name
(OC-6-2′2)-Dichlorido(2,4-dioxopentan-3-ido-κ2O,O′)titanium
|
| Other names
dichlorobis(2,4-pentanedionato)titanium, dichlorobis(2,4-acetylacetonato)titanium, bis(acetylacetonato)dichlorotitanium
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
| EC Number
|
|
|
|
|
InChI=1S/2C5H8O2.2ClH.Ti/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;2*1H;/q;;;;+4/p-4/b2*4-3-;;; Key: LUDYOTBRNXNKAB-VGKOASNMSA-J
|
ionic form: CC(=CC(=O)C)[O-].CC(=CC(=O)C)[O-].[Cl-].[Cl-].[Ti+4] coordination form: Cl[Ti-2]12(Cl)(OC(C)=CC(C)=[O+]1)OC(C)=CC(C)=[O+]2
|
| Properties
|
|
|
C10H14Cl2O4Ti
|
| Molar mass
|
316.99 g·mol−1
|
| Appearance
|
red-orange solid
|
| Density
|
1.514 g/cm3
|
| Melting point
|
191 °C (376 °F; 464 K)
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
| Infobox references
|
|
|
|
Tracking categories (test):
Titanium bis(acetylacetonate)dichloride is the coordination complex with the formula Ti(C5H7O2)2Cl2. It is a common acetylacetonate complex of titanium. It is a red-orange solid that hydrolyzes slowly in air.[1]
The complex is prepared by treatment of titanium tetrachloride with excess acetylacetone:[1]
- TiCl4 + 2 Hacac → Ti(acac)2Cl2 + 2 HCl
It is an octahedral complex that crystallizes as a racemic mixture of the chiral cis isomers.[2] It is fluxional in solution, as the result of rapid cis–trans equilibrium.[3]
References
- ↑ 1.0 1.1 Wilkie, C. A.; Lin, G.; Haworth, D. T. (1979). "cis-[Dihalobis(2,4-Pentanedionato)Titanium(IV)] Complexes". Inorg. Synth. 19: 145–148. doi:10.1002/9780470132500.ch33.
- ↑ Ferguson, George; Glidewell, Christopher (2001). "Enantiomeric disorder in racemic cis-dichlorobis(pentane-2,4-dionato)titanium(IV)". Acta Crystallographica Section C 57 (3): 264–265. doi:10.1107/S0108270100019181. PMID 11250571.
- ↑ Bradley, D. C.; Holloway, C. E. (1969). "Nuclear magnetic resonance and infrared spectral studies on labile cis-dialkoxy-bis(acetylacetonato)titanium(IV) compounds". J. Chem. Soc. A: 282–285. doi:10.1039/J19690000282.
|
|---|
| Titanium(II) | | Organotitanium(II) compounds | |
|---|
|
|---|
| Titanium(III) | | Organotitanium(III) compounds | |
|---|
|
|---|
| Titanium(IV) | | Organotitanium(IV) compounds | |
|---|
|
|---|
 | Original source: https://en.wikipedia.org/wiki/Titanium bis(acetylacetonate)dichloride. Read more |