3,4-Dimethoxycinnamic acid
|
| Names
|
Preferred IUPAC name
(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoic acid
|
| Other names
3-(3,4-Dimethoxyphenyl)propenoic acid; Caffeic acid dimethyl ether; Dimethyl caffeic acid; Dimethylcaffeic acid
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ Key: HJBWJAPEBGSQPR-GQCTYLIASA-N InChI=1/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ Key: HJBWJAPEBGSQPR-GQCTYLIABS
|
COC1=C(C=C(C=C1)/C=C/C(=O)O)OC
|
| Properties
|
|
|
C11H12O4
|
| Molar mass
|
208.213 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
| Infobox references
|
|
|
|
Tracking categories (test):
3,4-Dimethoxycinnamic acid is a cinnamic acid derivative isolated from coffee beans.[1]
References
- ↑ Andrade, P.B; Leitão, R; Seabra, R.M; Oliveira, M.B; Ferreira, M.A (1998). "3,4-Dimethoxycinnamic acid levels as a tool for differentiation of Coffea canephora var. Robusta and Coffea arabica". Food Chemistry 61 (4): 511. doi:10.1016/S0308-8146(97)00067-8.
 | Original source: https://en.wikipedia.org/wiki/3,4-Dimethoxycinnamic acid. Read more |