4-(Γ-Glutamylamino)Butanoic Acid

From Handwiki

4-(γ-Glutamylamino)butanoic acid
Stereo, skeletal formula of 4-(γ-glutamylamino)butanoic acid (S)
Names
Preferred IUPAC name
2-Amino-5-[(4-hydroxy-4-oxobutyl)amino]-5-oxopentanoic acid[citation needed]
Systematic IUPAC name
4-Amino-5-((3-carboxypropyl)amino)-5-oxopentanoic acid[citation needed]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☑Y verify (what is ☑Y☒N ?)
Infobox references

|Section1=! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers

|-













| CASNo = 5105-96-4 | CASNo_Ref =  ☑Y | CASNo_Comment = S | PubChem = 355553 | PubChem1 = 23724570 | PubChem1_Comment = S | ChemSpiderID = 315618 | ChemSpiderID_Ref =  ☑Y | KEGG = C15767 | KEGG_Ref =  ☑Y | ChEBI = 49260 | ChEBI_Ref =  ☑Y | ChEMBL = 269574 | ChEMBL_Ref =  ☑Y | Beilstein = 2418119 | SMILES = NC(CCC(=O)NCCCC(O)=O)C(O)=O | StdInChI = 1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16) | StdInChI_Ref =  ☑Y | StdInChIKey = MKYPKZSGLSOGLL-UHFFFAOYSA-N | StdInChIKey_Ref =  ☑Y }} |Section2=! colspan=2 style="background: #f8eaba; text-align: center;" |Properties

|-

|

Chemical formula

| C9H16N2O5

|- | Molar mass

| 232.236 g·mol−1

|-









| log P | −1.434 |-


| Acidity (pKa) | 2.223 |- | Basicity (pKb) | 11.777 |- |Section3=! colspan=2 style="background: #f8eaba; text-align: center;" |Related compounds

|-


|

Related alkanoic acids

|

  • Hopantenic acid
  • Hypusine
  • Saccharopine

|- }}

4-(γ-Glutamylamino)butanoic acid is molecule that consists of L-glutamate conjugated to γ-aminobutyric acid (GABA). It is the substrate of the enzyme γ-glutamyl-γ-aminobutyrate hydrolase, which is involved in the biosynthesis of polyamines.[1]

References

  1. "A novel putrescine utilization pathway involves gamma-glutamylated intermediates of Escherichia coli K-12". J. Biol. Chem. 280 (6): 4602–8. 2005. doi:10.1074/jbc.M411114200. PMID 15590624. 




Retrieved from "https://handwiki.org/wiki/index.php?title=Chemistry:4-(γ-Glutamylamino)butanoic_acid&oldid=2470969"

Categories: [Alpha-Amino acids] [Amino acid derivatives] [Biosynthesis] [Dicarboxylic acids]


Download as ZWI file | Last modified: 05/29/2024 05:26:07 | 24 views
☰ Source: https://handwiki.org/wiki/Chemistry:4-(γ-Glutamylamino)butanoic_acid | License: CC BY-SA 3.0

ZWI is not signed. [what is this?]