Fluoride Phosphate

From Handwiki

Short description: Class of chemical compounds


The fluoride phosphates or phosphate fluorides are inorganic double salts that contain both fluoride and phosphate anions. In mineralogy, Hey's Chemical Index of Minerals groups these as 22.1. The Nickel-Strunz grouping is 8.BN.

Related mixed anion compounds are the chloride phosphates, the fluoride arsenates and fluoride vanadates.

They are distinct from the fluorophosphates: monofluorophosphate, difluorophosphate and hexafluorophosphate which have fluorine bonds to the phosphorus.

Minerals

name formula ratio

PO4:F

formula weight crystal system space group unit cell volume density refractive index comment reference
Althausite Mg4(PO4)2(OH,O)(F,☐) 2:~1 Orthorhombic Pnma a = 8.258 b = 6.054, c = 14.383 719.06 2.97 Biaxial (+) nα = 1.588 nβ = 1.592 nγ = 1.598

2V: measured: 70° , calculated: 80°

Max birefringence: δ = 0.010

[1]
Amblygonite LiAl(PO4)F 1:1 Triclinic P1 a = 6.644 b = 7.744 c = 6.91

α = 90.35°, β = 117.33°, γ = 91.01° Z=4

315.75 3.04-3.11 Biaxial (-) nα = 1.577 - 1.591 nβ = 1.592 - 1.605 nγ = 1.596 - 1.613

2V: Measured: 107° to 129.5°

Birefringence: 0.020

[2]
aravaite Ba2Ca18(SiO4)6(PO4)3(CO3)F3O 3:3 trigonal R3m a = 7.1255, c = 66.290 Z=3 2914.8 [3]
Arctite Na2Ca4(PO4)3F 3:1 Trigonal R3m a = 7.078 c = 41.203 Z=6 1,787.64 3.13 Uniaxial (-) nω = 1.578 nε = 1.577 Birefringence: 0.001 [4]
Ariegilatite BaCa12(SiO4)4(PO4)2F2O Trigonal R3m a = 7.1551 c = 41.303 1381.2 Uniaxial (-) nω = 1.650 nε = 1.647

Max Birefringence: δ = 0.003

[5]
Babefphite BaBePO4(F,OH) 1:~1 Tetragonal Uniaxial (+) nω = 1.629 nε = 1.632

Max birefringence: δ = 0.003

[6]
Belovite-(Ce) NaCeSr3(PO4)3F 3:1 Trigonal P3 a = 9.692 c = 7.201 585.80 4.19 Uniaxial (-) nω = 1.653 - 1.660 nε = 1.634 - 1.640

Birefringence: 0.015

[7]
Belovite-(La) NaLaSr3(PO4)3F 3:1 Trigonal P3 a = 9.647 c = 7.17 577.88 4.19 Uniaxial (-) nω = 1.653 nε = 1.635 - 1.636

Max birefringence: δ = 0.018

[8]
Bøggildite Na2Sr2Al2PO4F9 1:9 Monoclinic Biaxial (+) nα = 1.462 nβ = 1.466 nγ = 1.469

2V: 80° Max birefringence:δ = 0.007

[9]
Carlgieseckeite-(Nd) NaNdCa3(PO4)3F Trigonal P3 a = 9.4553 c = 6.9825 540.62 3.91 [10]
Cloncurryite Cu0.5(VO)0.5Al2(PO4)2F2 · 5H2O 2:2 Monoclinic P21/b a = 4.9573 b = 12.1824 c = 18.9749 β = 90.933° Z=4 1145.78 2.525 Biaxial (-) nα = 1.548(2) nγ = 1.550(2)

2V: calculated: 56°

Max brefringence: δ = 0.002

[11]
Deloneite (Na0.5REE0.25Ca0.25)(Ca0.75REE0.25)Sr1.5(CaNa0.25REE0.25)(PO4)3F0.5(OH)0.5 Trigonal P3 a = 9.51 c = 7.01 Z=2 549.05 3.92 Uniaxial (-) nω = 1.682 nε = 1.660

Max birefringence: δ = 0.022

[12]
Fluellite Al2(PO4)F2(OH) · 7H2O Orthorhombic Fddd a = 11.22 b = 21.15 c = 8.54 2,027 2.139 - 2.17 Biaxial (+) nα = 1.473 - 1.490 nβ = 1.490 - 1.496 nγ = 1.506 - 1.511

Max birefringence: δ = 0.033

[13]
Fluorapatite Ca5(PO4)3F 3:1 Hexagonal P63/m a = 9.3973 c = 6.8782 526.03 3.1-3.25 Uniaxial (-) nω = 1.631 - 1.650 nε = 1.627 - 1.646

Birefringence: 0.004

[14]
Fluorcaphite SrCaCa3(PO4)3F 3:1 Hexagonal P63/m a = 9.485 c = 7.000 Z=2 545.39 Uniaxial (-) nω = 1.649 nε = 1.637

Max birefringence: δ = 0.012

[15]
Fluorphosphohedyphane Ca2Pb3(PO4)3F 3:1 Hexagonal P63/m a = 9.640, c = 7.012 Z=2 564.4 5.445 Uniaxial (-) nω = 1.836 nε = 1.824

Max birefringence: δ = 0.012

[16]
Fluorstrophite SrCaSr3(PO4)3F 3:1 Hexagonal P63/m a = 9.565 c = 7.115 Z=2 563.74 Uniaxial (-) nω = 1.651 nε = 1.637

Max birefringence: δ = 0.014

[17]
Francolite
Herderite CaBe(PO4)F Monoclinic a = 4.81, b = 7.7 c = 9.82 β = 90.1° 363.7 3.02 Biaxial (-) nα = 1.556 - 1.592 nβ = 1.578 - 1.610 nγ = 1.589 - 1.620

2V: calculated: 70°

Max birefringence: δ = 0.033

[18]
Iangreyite Ca2Al7(PO4)2(PO3OH)2(OH,F)15 · 8H2O 4:~15 Trigonal P3 2 1 a = 6.988 c = 16.707 706.5 [19]
Isokite CaMg(PO4)F Monoclinic B2/b a = 6.52 b = 8.75 c = 7.51 β = 121.47° 365.4 3.15-3.27 Biaxial (+) nα = 1.590 nβ = 1.595 nγ = 1.615

2V: ,easured: 51°

Max birefringence: δ = 0.025

[20]
Kingite Al3(PO4)2F2(OH) · 7H2O 2:2 Triclinic a = 9.15 b = 10 c = 7.24

α = 98.6°, β = 93.6°, γ = 93.2°

Biaxial [21]
Kuannersuite-(Ce) NaCeBa3(PO4)3F0.5Cl0.5 6:1 Trigonal P3 a = 9.909 c = 7.402 629.42 4.51 [22]
Lacroixite NaAl(PO4)F 1:1 Monoclinic B2/b a = 6.414 b = 8.207 c = 6.885 β = 115.47° 327.20 3.126 - 3.29 Biaxial (-) nα = 1.546 nβ = 1.563 nγ = 1.580

2V: measured: 89°

Birefringence: 0.034

[23]
Mcauslanite Fe3Al2(PO4)3(PO3OH)F · 18H2O 4:1 Triclinic a = 10.05 b = 11.56 c = 6.88

α = 105.84°, β = 93.66°, γ = 106.47°

728.7 Biaxial (-) nα = 1.522 nβ = 1.531 nγ = 1.534

2V: measured: 55° to 59.7°, calculated: 58°

Max birefringence:δ = 0.012

[24]
Minyulite KAl2(PO4)2(OH,F) · 4H2O 2:~1 Orthorhombic Pba2 a = 9.34 b = 9.74 c = 5.52 502 2.47 Biaxial (+) nα = 1.531 nβ = 1.534 nγ = 1.538

2V: measured: 70° , calculated: 82°

Max birefringence: δ = 0.007

[25]
Miyahisaite (Sr,Ca)2Ba3(PO4)3F 3:1 Hexagonal P63/m a = 9.921, c = 7.469 Z=2 636.7 4.511 [26]
Morinite NaCa2Al2(PO4)2(OH)F4 · 2H2O 2:4 Monoclinic 2.94 Biaxial (-) nα = 1.551 nβ = 1.563 nγ = 1.565

2V: measured: 43° , calculated: 44°

Max birefringence: δ = 0.014

[27]
Nacaphite Na2Ca(PO4)F Monoclinic P21/b a = 13.318 b = 7.0964 c = 10.6490 β = 113.526° Z=8 922.81 Biaxial (-) nα = 1.508 nβ = 1.515 nγ = 1.520

2V: 80° Max birefringence: δ = 0.012

[28]
natrophosphate Na7(PO4)2F.19H2O 2:1 Isometric Fd3c a = 27.79 Z=56 21,461.78 1,71-1.72 Isotropic [29][30]
Nefedovite Na5Ca4(PO4)4F 4:1 Triclinic a = 5.4 Å, b = 11.64 Å, c = 16.48 Å

α = 134.99°, β = 90.04°, γ = 89.96°

732.60 Biaxial (+) nα = 1.571 nγ = 1.590

Max birefringence: δ = 0.019

[31]
Nevadaite (Cu2+,Al,V3+)6Al8(PO4)8F8(OH)2 · 22H2O 8:8 Orthorhombic P21mn a = 12.123 b = 18.999 c = 4.961 2.54 Biaxial (-) nα = 1.540 nβ = 1.548 nγ = 1.553

2V: measured: 76°, calculated: 76°

Max birefringence: δ = 0.013

[32]
Panasqueiraite CaMg(PO4)(OH,F) 1:~1 monoclinic a = 6.53 b = 8.75 c = 6.91 β = 112.33° 365.2 3.27 Biaxial (+) nα = 1.590 nβ = 1.596 nγ = 1.616

2V: measured: 51° , calculated: 58°

Max birefringence: δ = 0.026

[33]
Richellite CaFe3+2(PO4)2(OH,F)2 2:~2 a = 5.18 c = 12.61 [34]
Stronadelphite Sr5(PO4)3F 3:1 Hexagonal P63/m a = 9.845 c = 7.383 619.72 Uniaxial (-) nω = 1.630(1) nε = 1.623(1)

Max birefringence: δ = 0.007

[35]
Triplite Mn2+2(PO4)F 1:1 Monoclinic P21/b a = 11.9 b = 6.52 c = 10.09 β = 105.62° 758.4 3.9 Biaxial (+) nα = 1.650 nβ = 1.660 nγ = 1.680

2V: measured: 70° to 90°, calculated: 72°

Max birefringence: δ = 0.030

[36]
Väyrynenite Mn2+Be(PO4)(OH,F) 1:~1 Monoclinic P21/b a = 5.411 b = 14.49 c = 4.73 β = 102.75° 361.71 3.22 Biaxial (-) nα = 1.638 - 1.640 nβ = 1.658 - 1.662 nγ = 1.664 - 1.667

2V: measured: 46° to 55°, Calculated: 51° to 57°

Max birefringence: δ = 0.026 - 0.027

[37]
Viitaniemiite Na(Ca,Mn2+)Al(PO4)(F,OH)3 1:~3 Monoclinic a = 6.83 b = 7.14 c = 5.44 β = 109.37° 250.27 Biaxial (-) nα = 1.557 nβ = 1.565 nγ = 1.571

2V: measured: 81° , calculated: 80°

Max birefringence: δ = 0.014

[38]
Wagnerite (Mg,Fe2+)2(PO4)F 1:1 Monoclinic P21/b a = 9.645 b = 31.659 c = 11.914 β = 108.26(3)° 3454.8 3.15 Biaxial (+) nα = 1.568 nβ = 1.572 nγ = 1.582

2V: Measured: 25° to 35°

? Birefringence:0.046

Max birefringence: δ = 0.015

[39]
Wavellite Al3(PO4)2(OH,F)3 · 5H2O 2:~3 Orthorhombic a = 9.621 b = 17.363 c = 6.994 1168.3 2.36 Biaxial (+) nα = 1.518 - 1.535 nβ = 1.524 - 1.543 nγ = 1.544 - 1.561

2V: measured: 60° to 72°, calculated: 60° to 70°

Max birefringence: δ = 0.026

[40]
Zwieselite Fe2+2(PO4)F 1:1 Monoclinic P21/b 753.82 Biaxial (+) nα = 1.686 - 1.696 nβ = 1.690 - 1.704 nγ = 1.703 - 1.713

2V: measured: 58° , calculated: 60°

Max birefringence: δ = 0.017

[41]
Na5-4.5PO4(CO3,F,Cl) 1:~1 [29]

Artificial

name formula formula weight crystal system space group unit cell Å volume density refractive index comment reference
EMM-9; 4-(dimethylamino)pyridine fluoroaluminophosphate (DMAP)2Al4P4O17F2•H2O monoclinic P21/a a=14.335 b=13.561 c=14.497 β =101.094° layered [42]
KBPO4F monoclinic Cc [43]
Iron-Doped Sodium–Vanadium Fluorophosphate Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3) tetrahedral P42/mnm a=9.0277 c=10.6259 866.0 [44]
Na3V2O1.6(PO4)2F1.4 [44]
Na3V2(PO4)2F3 [45]
Na2MnPO4F [46]
α Na2FePO4F monoclinic P21/c a = 13.675, b = 5.2503, c = 13.7202, β = 120.230° [46]
β Na2FePO4F orthorhombic [46]
RbBPO4F 210.25 cubic P213 a=7.5901 Z=4 437.26 3.194 colourless [43]
MIL-145 RbGa3(PO4)2(HPO4)F4·C5N2H16·2H2O 3187.11 monoclinic P2 a=14.4314 b=9.1152 c=16.7889 β = 112.708 Z=1 2037.30 2.598 colourless [47]
K2SnPO4F3 348.86 monoclinic P21/c a=10.039 b=9.415 c=21.602 beta=95.464 Z=12 2032.6 3.420 colourless [48]
K6Sn(P2O7)2F2 739.17 monoclinic P21/c a=8.515 b=12.400 c=8.403 beta=99.58 Z=29 874.8 2.806 colourless [48]
K2Sb(P2O7)F tetragonal P4bm a=8.5239 c=5.572 Z=2 404.8 3.223 colourless SHG 4.0×KDP [49]
CsBPO4F cubic P213 a=7.7090 Z=4 458.14 3.736 colourless [43]
Na2PrF2(PO4) cubic [50]
Na2NdF2(PO4) cubic [50]
Na2SmF2(PO4) cubic [50]
Na2EuF2(PO4) cubic [50]
Na2TbF2(PO4) cubic [50]
Na2PrF2(PO4) cubic [50]
Sr4Gd3Na3(PO4)6F2 [51]
PbZn(PO4)F 386.53 orthorhombic Pna21 a=8.985 b=9.381 c=4.8212 Z=4 406.4 6.318 colourless [52]

References

  1. "Althausite: Mineral information, data and localities.". https://www.mindat.org/min-148.html. 
  2. "Amblygonite: Mineral information, data and localities.". https://www.mindat.org/min-189.html. 
  3. Krüger, Biljana; Krüger, Hannes; Galuskin, Evgeny V.; Galuskina, Irina O.; Vapnik, Yevgeny; Olieric, Vincent; Pauluhn, Anuschka (2018-12-01). "Aravaite, Ba 2 Ca 18 (SiO 4 ) 6 (PO 4 ) 3 (CO 3 )F 3 O: modular structure and disorder of a new mineral with single and triple antiperovskite layers". Acta Crystallographica Section B 74 (6): 492–501. doi:10.1107/S2052520618012271. ISSN 2052-5206. Bibcode2018AcCrB..74..492K. http://scripts.iucr.org/cgi-bin/paper?S2052520618012271. 
  4. "Arctite: Mineral information, data and localities.". https://www.mindat.org/min-316.html. 
  5. "Ariegilatite: Mineral information, data and localities.". https://www.mindat.org/min-51569.html. 
  6. "Babefphite: Mineral information, data and localities.". https://www.mindat.org/min-476.html. 
  7. "Belovite-(Ce): Mineral information, data and localities.". https://www.mindat.org/min-618.html. 
  8. "Belovite-(La): Mineral information, data and localities.". https://www.mindat.org/min-6822.html. 
  9. "Bøggildite: Mineral information, data and localities.". https://www.mindat.org/min-703.html. 
  10. "Carlgieseckeite-(Nd): Mineral information, data and localities.". https://www.mindat.org/min-40295.html. 
  11. "Cloncurryite: Mineral information, data and localities.". https://www.mindat.org/min-29262.html. 
  12. "Deloneite: Mineral information, data and localities.". https://www.mindat.org/min-6900.html. 
  13. "Fluellite: Mineral information, data and localities.". https://www.mindat.org/min-1565.html. 
  14. "Fluorapatite: Mineral information, data and localities.". https://www.mindat.org/min-1572.html. 
  15. "Fluorcaphite: Mineral information, data and localities.". https://www.mindat.org/min-6948.html. 
  16. "Fluorphosphohedyphane: Mineral information, data and localities.". https://www.mindat.org/min-39334.html. 
  17. "Fluorstrophite: Mineral information, data and localities.". https://www.mindat.org/min-3757.html. 
  18. "Herderite: Mineral information, data and localities.". https://www.mindat.org/min-1876.html. 
  19. "Iangreyite: Mineral information, data and localities.". https://www.mindat.org/min-39883.html. 
  20. "Isokite: Mineral information, data and localities.". https://www.mindat.org/min-2054.html. 
  21. "Kingite: Mineral information, data and localities.". https://www.mindat.org/min-2210.html. 
  22. "Kuannersuite-(Ce): Mineral information, data and localities.". https://www.mindat.org/min-25711.html. 
  23. "Lacroixite: Mineral information, data and localities.". https://www.mindat.org/min-2310.html. 
  24. "Mcauslanite: Mineral information, data and localities.". https://www.mindat.org/min-2610.html. 
  25. "Minyulite: Mineral information, data and localities.". https://www.mindat.org/min-2724.html. 
  26. "Miyahisaite: Mineral information, data and localities.". https://www.mindat.org/min-42835.html. 
  27. "Morinite: Mineral information, data and localities.". https://www.mindat.org/min-2785.html. 
  28. "Nacaphite: Mineral information, data and localities.". https://www.mindat.org/min-2824.html. 
  29. 29.0 29.1 Mitchell, R. H. (5 July 2018). "An ephemeral pentasodium phosphate carbonate from natrocarbonatite lapilli, Oldoinyo Lengai, Tanzania". Mineralogical Magazine 70 (2): 211–218. doi:10.1180/0026461067020326. 
  30. "Natrophosphate: Mineral information, data and localities.". https://www.mindat.org/min-2862.html. 
  31. "Nefedovite: Mineral information, data and localities.". https://www.mindat.org/min-2870.html. 
  32. "Nevadaite: Mineral information, data and localities.". https://www.mindat.org/min-25696.html. 
  33. "Panasqueiraite: Mineral information, data and localities.". https://www.mindat.org/min-3073.html. 
  34. "Richellite: Mineral information, data and localities.". https://www.mindat.org/min-3413.html. 
  35. "Stronadelphite: Mineral information, data and localities.". https://www.mindat.org/min-35973.html. 
  36. "Triplite: Mineral information, data and localities.". https://www.mindat.org/min-4021.html. 
  37. "Väyrynenite: Mineral information, data and localities.". https://www.mindat.org/min-4220.html. 
  38. "Viitaniemiite: Mineral information, data and localities.". https://www.mindat.org/min-4178.html. 
  39. "Wagnerite: Mineral information, data and localities.". https://www.mindat.org/min-4229.html. 
  40. "Wavellite: Mineral information, data and localities.". https://www.mindat.org/min-4250.html. 
  41. "Zwieselite: Mineral information, data and localities.". https://www.mindat.org/min-4436.html. 
  42. Guo, Peng; Afeworki, Mobae; Cao, Guang; Yun, Yifeng; Sun, Junliang; Su, Jie; Wan, Wei; Zou, Xiaodong (2018-09-17). "Synthesis and Structure of a Layered Fluoroaluminophosphate and Its Transformation to a Three-Dimensional Zeotype Framework" (in en). Inorganic Chemistry 57 (18): 11753–11760. doi:10.1021/acs.inorgchem.8b01890. ISSN 0020-1669. PMID 30156401. https://pubs.acs.org/doi/10.1021/acs.inorgchem.8b01890. 
  43. 43.0 43.1 43.2 Ding, Qingran; Zhao, Sangen; Li, Lina; Shen, Yaoguo; Shan, Pai; Wu, Zhenyue; Li, Xianfeng; Li, Yanqiang et al. (2019-02-04). "Abrupt Structural Transformation in Asymmetric ABPO 4 F (A = K, Rb, Cs)" (in en). Inorganic Chemistry 58 (3): 1733–1737. doi:10.1021/acs.inorgchem.8b02754. ISSN 0020-1669. PMID 30652880. https://pubs.acs.org/doi/10.1021/acs.inorgchem.8b02754. 
  44. 44.0 44.1 Palomares, Verónica; Iturrondobeitia, Amaia; Sanchez-Fontecoba, Paula; Goonetilleke, Damian; Sharma, Neeraj; Lezama, Luis; Rojo, Teófilo (16 December 2019). "Iron-Doped Sodium–Vanadium Fluorophosphates: Na3V2–yO2–yFey(PO4)2F1+y (y < 0.3)". Inorganic Chemistry 59 (1): 854–862. doi:10.1021/acs.inorgchem.9b03111. PMID 31840984. 
  45. Semykina, Daria O.; Sharafutdinov, Marat R.; Kosova, Nina V. (2022-06-24). "Understanding of the Mechanism and Kinetics of the Fast Solid-State Reaction between NaF and VPO 4 to Form Na 3 V 2 (PO 4 ) 2 F 3" (in en). Inorganic Chemistry 61 (26): 10023–10035. doi:10.1021/acs.inorgchem.2c00951. ISSN 0020-1669. PMID 35748412. https://pubs.acs.org/doi/10.1021/acs.inorgchem.2c00951. 
  46. 46.0 46.1 46.2 Kirsanova, Maria A.; Akmaev, Alexey S.; Aksyonov, Dmitry A.; Ryazantsev, Sergey V.; Nikitina, Victoria A.; Filimonov, Dmitry S.; Avdeev, Maxim; Abakumov, Artem M. (2020-11-16). "Monoclinic α-Na 2 FePO 4 F with Strong Antisite Disorder and Enhanced Na + Diffusion" (in en). Inorganic Chemistry 59 (22): 16225–16237. doi:10.1021/acs.inorgchem.0c01961. ISSN 0020-1669. PMID 33137251. https://pubs.acs.org/doi/10.1021/acs.inorgchem.0c01961. 
  47. Martineau, Charlotte; Loiseau, Thierry; Beitone, Lionel; Férey, Gérard; Bouchevreau, Boris; Taulelle, Francis (2013). "Single-crystal XRD and solid-state NMR structural resolution of a layered fluorinated gallium phosphate: RbGa 3 (PO 4 ) 2 (HPO 4 )F 4 ·C 5 N 2 H 16 ·2H 2 O (MIL-145)" (in en). Dalton Trans. 42 (2): 422–431. doi:10.1039/C2DT31464A. ISSN 1477-9226. PMID 23069866. http://xlink.rsc.org/?DOI=C2DT31464A. 
  48. 48.0 48.1 Hu, Shuaishuai; Su, Zhi (2019). "Two new tin( iv )-containing phosphate fluorides with two types of Sn( iv )–P–O–F frameworks and short cutoff edges" (in en). New Journal of Chemistry 43 (41): 16127–16130. doi:10.1039/C9NJ04424H. ISSN 1144-0546. http://xlink.rsc.org/?DOI=C9NJ04424H. 
  49. Deng, Yalan; Huang, Ling; Dong, Xuehua; Wang, Lei; Ok, Kang Min; Zeng, Hongmei; Lin, Zhien; Zou, Guohong (2020-11-16). "K 2 Sb(P 2 O 7 )F: Cairo Pentagonal Layer with Bifunctional Genes Reveal Optical Performance" (in en). Angewandte Chemie International Edition 59 (47): 21151–21156. doi:10.1002/anie.202009441. ISSN 1433-7851. PMID 32745331. Bibcode2020ACIE...5921151D. https://onlinelibrary.wiley.com/doi/10.1002/anie.202009441. 
  50. 50.0 50.1 50.2 50.3 50.4 50.5 Zimina, G. V.; Smirnova, I. N.; Gorkovenko, M. Yu.; Spiridonov, F. M.; Komissarova, L. N.; Kaloev, N. I. (1995-02-21). "ChemInform Abstract: Synthesis and Studies of Fluorophosphates of Rare Earth Elements Na2LnF2PO4." (in en). ChemInform 26 (8). doi:10.1002/chin.199508015. ISSN 0931-7597. https://onlinelibrary.wiley.com/doi/10.1002/chin.199508015. 
  51. Tikale, Rahul V.; Kadam, Abhijeet R.; Dhoble, S. J. (2025-08-09). "Comprehensive photoluminescence analysis and Judd-Ofelt analysis of eu³⁺-Activated Sr₄Gd₃Na₃(PO₄)₆F₂ phosphor: theoretical elucidation from PL emission spectra for optimized red emission" (in en). Optical and Quantum Electronics 57 (8). doi:10.1007/s11082-025-08407-6. ISSN 1572-817X. https://link.springer.com/10.1007/s11082-025-08407-6. 
  52. li, xiaobao; Hu, Chun-Li; Kong, Fang; Mao, Jiang-Gao (2023). "Structure and Optical Property Evolutions in PbM(PO4)X (M = Zn, Sn; X = halogen): SHG Effect and Birefringence" (in en). Inorganic Chemistry Frontiers 10 (8): 2268–2275. doi:10.1039/D3QI00230F. ISSN 2052-1553. 




Categories: [Fluorides] [Phosphates] [Mixed anion compounds]


Download as ZWI file | Last modified: 05/14/2026 00:47:15 | 21 views
☰ Source: https://handwiki.org/wiki/Chemistry:Fluoride_phosphate | License: CC BY-SA 3.0

ZWI is not signed. [what is this?]